C18H30N6O2 — CID 70129820
7-cyclohexyl-1,3,4-trimethyl-8-piperazin-1-yl-5H-purine-2,6-dione (PubChem CID 70129820) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 7-cyclohexyl-1,3,4-trimethyl-8-piperazin-1-yl-5H-purine-2,6-dione.
| Compound Name | 7-cyclohexyl-1,3,4-trimethyl-8-piperazin-1-yl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 70129820 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 7-cyclohexyl-1,3,4-trimethyl-8-piperazin-1-yl-5H-purine-2,6-dione |
| SMILES | CN1C(=O)C2N(C3CCCCC3)C(N3CCNCC3)=NC2(C)N(C)C1=O |
| InChI | InChI=1S/C18H30N6O2/c1-18-14(15(25)21(2)17(26)22(18)3)24(13-7-5-4-6-8-13)16(20-18)23-11-9-19-10-12-23/h13-14,19H,4-12H2,1-3H3 |
| InChIKey | JRKJPQFXVADNDT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |