C15H23ClN6O3 — CID 142690148
5-chloro-N,N-diethyl-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide (PubChem CID 142690148) has the molecular formula C15H23ClN6O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 5-chloro-N,N-diethyl-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide.
| Compound Name | 5-chloro-N,N-diethyl-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
|---|---|
| PubChem CID | 142690148 |
| Molecular Formula | C15H23ClN6O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 5-chloro-N,N-diethyl-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboxamide |
| SMILES | CCN(CC)C(=O)N1C(=O)NC(=O)C2(Cl)N=CN(C3CCNCC3)C12 |
| InChI | InChI=1S/C15H23ClN6O3/c1-3-20(4-2)14(25)22-12-15(16,11(23)19-13(22)24)18-9-21(12)10-5-7-17-8-6-10/h9-10,12,17H,3-8H2,1-2H3,(H,19,23,24) |
| InChIKey | RVOPJBBZKHZAPM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|