C17H28N6O3 — CID 53237793
2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-piperidin-1-ylpropyl)acetamide (PubChem CID 53237793) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-piperidin-1-ylpropyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 53237793 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-(3-piperidin-1-ylpropyl)acetamide |
| SMILES | CN1C(=O)C2C(N=CN2CC(=O)NCCCN2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C17H28N6O3/c1-20-15-14(16(25)21(2)17(20)26)23(12-19-15)11-13(24)18-7-6-10-22-8-4-3-5-9-22/h12,14-15H,3-11H2,1-2H3,(H,18,24) |
| InChIKey | IJALPPREGTWQDO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|