C17H25ClN6O3 — CID 142689746
9-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-N,N-diethyl-2,6-dioxo-4H-purine-3-carboxamide (PubChem CID 142689746) has the molecular formula C17H25ClN6O3 and a molecular weight of 396.88 g/mol. Its IUPAC name is 9-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-N,N-diethyl-2,6-dioxo-4H-purine-3-carboxamide.
| Compound Name | 9-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-N,N-diethyl-2,6-dioxo-4H-purine-3-carboxamide |
|---|---|
| PubChem CID | 142689746 |
| Molecular Formula | C17H25ClN6O3 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 9-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-N,N-diethyl-2,6-dioxo-4H-purine-3-carboxamide |
| SMILES | CCN(CC)C(=O)N1C(=O)NC(=O)C2(Cl)N=CN(C3CC4CCC(C3)N4)C12 |
| InChI | InChI=1S/C17H25ClN6O3/c1-3-22(4-2)16(27)24-14-17(18,13(25)21-15(24)26)19-9-23(14)12-7-10-5-6-11(8-12)20-10/h9-12,14,20H,3-8H2,1-2H3,(H,21,25,26) |
| InChIKey | BNIYSCRAPLDXKP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|