C19H32ClN8O2+ — CID 143278794
9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-4-ium-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione (PubChem CID 143278794) has the molecular formula C19H32ClN8O2+ and a molecular weight of 439.97 g/mol. Its IUPAC name is 9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-4-ium-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione.
| Compound Name | 9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-4-ium-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione |
|---|---|
| PubChem CID | 143278794 |
| Molecular Formula | C19H32ClN8O2+ |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-4-ium-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione |
| SMILES | CC[C@H]1CN(C2=NC3NC(=O)NCCNC(=O)C3N=C2Cl)CC[NH+]1C1CCNCC1 |
| InChI | InChI=1S/C19H31ClN8O2/c1-2-12-11-27(9-10-28(12)13-3-5-21-6-4-13)17-15(20)24-14-16(25-17)26-19(30)23-8-7-22-18(14)29/h12-14,16,21H,2-11H2,1H3,(H,22,29)(H2,23,26,30)/p+1/t12-,14?,16?/m0/s1 |
| InChIKey | AFONUBZSBFOOPS-YGONEPDPSA-O |
| XLogP | -2.11 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |