C19H31ClN8O2 — CID 143278795
9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione (PubChem CID 143278795) has the molecular formula C19H31ClN8O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione.
| Compound Name | 9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione |
|---|---|
| PubChem CID | 143278795 |
| Molecular Formula | C19H31ClN8O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 9-chloro-10-[(3S)-3-ethyl-4-piperidin-4-ylpiperazin-1-yl]-3,4,5,6,7a,11a-hexahydro-1H-pyrazino[2,3-h][1,3,6]triazonine-2,7-dione |
| SMILES | CC[C@H]1CN(C2=NC3NC(=O)NCCNC(=O)C3N=C2Cl)CCN1C1CCNCC1 |
| InChI | InChI=1S/C19H31ClN8O2/c1-2-12-11-27(9-10-28(12)13-3-5-21-6-4-13)17-15(20)24-14-16(25-17)26-19(30)23-8-7-22-18(14)29/h12-14,16,21H,2-11H2,1H3,(H,22,29)(H2,23,26,30)/t12-,14?,16?/m0/s1 |
| InChIKey | AFONUBZSBFOOPS-YGONEPDPSA-N |
| XLogP | -0.69 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |