C15H25N7O3 — CID 142690152
N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboximidamide (PubChem CID 142690152) has the molecular formula C15H25N7O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboximidamide.
| Compound Name | N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboximidamide |
|---|---|
| PubChem CID | 142690152 |
| Molecular Formula | C15H25N7O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N,N-diethyl-5-hydroxy-2,6-dioxo-9-piperidin-4-yl-4H-purine-3-carboximidamide |
| SMILES | [H]/N=C(\N(CC)CC)N1C(=O)NC(=O)C2(O)N=CN(C3CCNCC3)C12 |
| InChI | InChI=1S/C15H25N7O3/c1-3-20(4-2)13(16)22-12-15(25,11(23)19-14(22)24)18-9-21(12)10-5-7-17-8-6-10/h9-10,12,16-17,25H,3-8H2,1-2H3,(H,19,23,24)/b16-13+ |
| InChIKey | FJRNHHWUHVUJPM-DTQAZKPQSA-N |
| XLogP | -1.07 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|