C19H32N6O4 — CID 142123243
ethyl N-[N-[2-[(4-cyano-1-propylpiperidin-4-yl)amino]-2-oxoethyl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 142123243) has the molecular formula C19H32N6O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl N-[N-[2-[(4-cyano-1-propylpiperidin-4-yl)amino]-2-oxoethyl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[2-[(4-cyano-1-propylpiperidin-4-yl)amino]-2-oxoethyl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 142123243 |
| Molecular Formula | C19H32N6O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | ethyl N-[N-[2-[(4-cyano-1-propylpiperidin-4-yl)amino]-2-oxoethyl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CCCN1CCC(C#N)(NC(=O)C/N=C(\NC(=O)OCC)N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H32N6O4/c1-3-7-24-8-5-19(15-20,6-9-24)23-16(26)14-21-17(22-18(27)29-4-2)25-10-12-28-13-11-25/h3-14H2,1-2H3,(H,23,26)(H,21,22,27) |
| InChIKey | RHKPQTONGMGYDR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|