C21H37N5O3 — CID 109392974
2-[4-(N'-ethyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylcarbamimidoyl)piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 109392974) has the molecular formula C21H37N5O3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-[4-(N'-ethyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylcarbamimidoyl)piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-(N'-ethyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylcarbamimidoyl)piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 109392974 |
| Molecular Formula | C21H37N5O3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 2-[4-(N'-ethyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylcarbamimidoyl)piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CC/N=C(/NC1C2CCOC2C12CCC2)N1CCN(CC(=O)NCCOC)CC1 |
| InChI | InChI=1S/C21H37N5O3/c1-3-22-20(24-18-16-5-13-29-19(16)21(18)6-4-7-21)26-11-9-25(10-12-26)15-17(27)23-8-14-28-2/h16,18-19H,3-15H2,1-2H3,(H,22,24)(H,23,27) |
| InChIKey | UNSWLFGRFIWRPP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|