C18H32N4O3 — CID 110034479
2-[[(2-methoxyethylamino)-(spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110034479) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-(spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-methoxyethylamino)-(spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110034479 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-(spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NC1C2CCOC2C12CCCC2 |
| InChI | InChI=1S/C18H32N4O3/c1-22(2)14(23)12-20-17(19-9-11-24-3)21-15-13-6-10-25-16(13)18(15)7-4-5-8-18/h13,15-16H,4-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | LDTHRVVNEJXCFU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|