C22H32IN3O2 — CID 109393165
2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide (PubChem CID 109393165) has the molecular formula C22H32IN3O2 and a molecular weight of 497.42 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109393165 |
| Molecular Formula | C22H32IN3O2 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-ethyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc2c(c1)CCO2)NC1C2CCOC2C12CCC2.I |
| InChI | InChI=1S/C22H31N3O2.HI/c1-2-23-21(24-11-6-15-4-5-18-16(14-15)7-12-26-18)25-19-17-8-13-27-20(17)22(19)9-3-10-22;/h4-5,14,17,19-20H,2-3,6-13H2,1H3,(H2,23,24,25);1H |
| InChIKey | FTZURXJSNXZZPY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|