C22H33N3O2 — CID 109393444
1-[3-(4-methoxyphenyl)butyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine (PubChem CID 109393444) has the molecular formula C22H33N3O2 and a molecular weight of 371.52 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)butyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine.
| Compound Name | 1-[3-(4-methoxyphenyl)butyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
|---|---|
| PubChem CID | 109393444 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)butyl]-2-methyl-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylguanidine |
| SMILES | C/N=C(\NCCC(C)c1ccc(OC)cc1)NC1C2CCOC2C12CCC2 |
| InChI | InChI=1S/C22H33N3O2/c1-15(16-5-7-17(26-3)8-6-16)9-13-24-21(23-2)25-19-18-10-14-27-20(18)22(19)11-4-12-22/h5-8,15,18-20H,4,9-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | QZSSAMVGFTUIQN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|