C24H38O3Se — CID 10939370
8-[5-(1-phenylselanylhexyl)oxolan-2-yl]octanoic acid (PubChem CID 10939370) has the molecular formula C24H38O3Se and a molecular weight of 453.53 g/mol. Its IUPAC name is 8-[5-(1-phenylselanylhexyl)oxolan-2-yl]octanoic acid.
| Compound Name | 8-[5-(1-phenylselanylhexyl)oxolan-2-yl]octanoic acid |
|---|---|
| PubChem CID | 10939370 |
| Molecular Formula | C24H38O3Se |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 8-[5-(1-phenylselanylhexyl)oxolan-2-yl]octanoic acid |
| SMILES | CCCCCC([Se]c1ccccc1)C1CCC(CCCCCCCC(=O)O)O1 |
| InChI | InChI=1S/C24H38O3Se/c1-2-3-8-16-23(28-21-14-10-7-11-15-21)22-19-18-20(27-22)13-9-5-4-6-12-17-24(25)26/h7,10-11,14-15,20,22-23H,2-6,8-9,12-13,16-19H2,1H3,(H,25,26) |
| InChIKey | VDZRKKUHCUPGHJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|