C25H38N2O4Si — CID 10939456
(R)-quinolin-4-yl-[(2S,4S,5R)-5-(2-triethoxysilylethyl)-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 10939456) has the molecular formula C25H38N2O4Si and a molecular weight of 458.68 g/mol. Its IUPAC name is (R)-quinolin-4-yl-[(2S,4S,5R)-5-(2-triethoxysilylethyl)-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | (R)-quinolin-4-yl-[(2S,4S,5R)-5-(2-triethoxysilylethyl)-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 10939456 |
| Molecular Formula | C25H38N2O4Si |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (R)-quinolin-4-yl-[(2S,4S,5R)-5-(2-triethoxysilylethyl)-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | CCO[Si](CC[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccccc12)(OCC)OCC |
| InChI | InChI=1S/C25H38N2O4Si/c1-4-29-32(30-5-2,31-6-3)16-13-20-18-27-15-12-19(20)17-24(27)25(28)22-11-14-26-23-10-8-7-9-21(22)23/h7-11,14,19-20,24-25,28H,4-6,12-13,15-18H2,1-3H3/t19-,20-,24-,25+/m0/s1 |
| InChIKey | ATUQVPCAEHLCJQ-OTLGMJNYSA-N |
| XLogP | 4.42 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|