C28H46N2OSi2 — CID 11155933
triethyl-[2-[(3R,4S,6S)-6-[(R)-quinolin-4-yl(trimethylsilyloxy)methyl]-1-azabicyclo[2.2.2]octan-3-yl]ethyl]silane (PubChem CID 11155933) has the molecular formula C28H46N2OSi2 and a molecular weight of 482.86 g/mol. Its IUPAC name is triethyl-[2-[(3R,4S,6S)-6-[(R)-quinolin-4-yl(trimethylsilyloxy)methyl]-1-azabicyclo[2.2.2]octan-3-yl]ethyl]silane.
| Compound Name | triethyl-[2-[(3R,4S,6S)-6-[(R)-quinolin-4-yl(trimethylsilyloxy)methyl]-1-azabicyclo[2.2.2]octan-3-yl]ethyl]silane |
|---|---|
| PubChem CID | 11155933 |
| Molecular Formula | C28H46N2OSi2 |
| Molecular Weight | 482.86 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | triethyl-[2-[(3R,4S,6S)-6-[(R)-quinolin-4-yl(trimethylsilyloxy)methyl]-1-azabicyclo[2.2.2]octan-3-yl]ethyl]silane |
| SMILES | CC[Si](CC)(CC)CC[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O[Si](C)(C)C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C28H46N2OSi2/c1-7-33(8-2,9-3)19-16-23-21-30-18-15-22(23)20-27(30)28(31-32(4,5)6)25-14-17-29-26-13-11-10-12-24(25)26/h10-14,17,22-23,27-28H,7-9,15-16,18-21H2,1-6H3/t22-,23-,27-,28+/m0/s1 |
| InChIKey | GPYCRCGUGZZROZ-PTRUDAKASA-N |
| XLogP | 7.74 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|