C26H31N2O3P — CID 51036188
4-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinoline;phosphenous acid (PubChem CID 51036188) has the molecular formula C26H31N2O3P and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinoline;phosphenous acid.
| Compound Name | 4-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinoline;phosphenous acid |
|---|---|
| PubChem CID | 51036188 |
| Molecular Formula | C26H31N2O3P |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]quinoline;phosphenous acid |
| SMILES | CCC1CN2CCC1CC2[C@H](OCc1ccccc1)c1ccnc2ccccc12.O=PO |
| InChI | InChI=1S/C26H30N2O.HO2P/c1-2-20-17-28-15-13-21(20)16-25(28)26(29-18-19-8-4-3-5-9-19)23-12-14-27-24-11-7-6-10-22(23)24;1-3-2/h3-12,14,20-21,25-26H,2,13,15-18H2,1H3;(H,1,2)/t20?,21?,25?,26-;/m1./s1 |
| InChIKey | LACAGWINYLUOJR-FJSXDBFBSA-N |
| XLogP | 5.80 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|