C56H58N4O4 — CID 134855537
bis[(S)-[(2R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate (PubChem CID 134855537) has the molecular formula C56H58N4O4 and a molecular weight of 851.10 g/mol. Its IUPAC name is bis[(S)-[(2R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate.
| Compound Name | bis[(S)-[(2R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate |
|---|---|
| PubChem CID | 134855537 |
| Molecular Formula | C56H58N4O4 |
| Molecular Weight | 851.10 g/mol |
| Exact Mass | 850.45 |
| IUPAC Name | bis[(S)-[(2R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylate |
| SMILES | CCC1CN2CCC1C[C@@H]2[C@@H](OC(=O)C1C2c3ccccc3C(c3ccccc32)C1C(=O)O[C@@H](c1ccnc2ccccc12)[C@H]1CC2CCN1CC2CC)c1ccnc2ccccc12 |
| InChI | InChI=1S/C56H58N4O4/c1-3-33-31-59-27-23-35(33)29-47(59)53(43-21-25-57-45-19-11-9-13-37(43)45)63-55(61)51-49-39-15-5-7-17-41(39)50(42-18-8-6-16-40(42)49)52(51)56(62)64-54(44-22-26-58-46-20-12-10-14-38(44)46)48-30-36-24-28-60(48)32-34(36)4-2/h5-22,25-26,33-36,47-54H,3-4,23-24,27-32H2,1-2H3/t33?,34?,35?,36?,47-,48-,49?,50?,51?,52?,53+,54+/m1/s1 |
| InChIKey | RWZJTCDFDZJOTB-NKIXVYPHSA-N |
| XLogP | 10.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.10 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |