C24H30N2O2 — CID 10785928
[(R)-[(2R,4S,5S)-5-pent-4-enyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate (PubChem CID 10785928) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is [(R)-[(2R,4S,5S)-5-pent-4-enyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate.
| Compound Name | [(R)-[(2R,4S,5S)-5-pent-4-enyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate |
|---|---|
| PubChem CID | 10785928 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [(R)-[(2R,4S,5S)-5-pent-4-enyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] acetate |
| SMILES | C=CCCC[C@@H]1CN2CC[C@H]1C[C@@H]2[C@H](OC(C)=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C24H30N2O2/c1-3-4-5-8-19-16-26-14-12-18(19)15-23(26)24(28-17(2)27)21-11-13-25-22-10-7-6-9-20(21)22/h3,6-7,9-11,13,18-19,23-24H,1,4-5,8,12,14-16H2,2H3/t18-,19+,23+,24+/m0/s1 |
| InChIKey | AWMBQCBNCCOWQK-PLXZFBFJSA-N |
| XLogP | 4.91 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|