C21H23FN2O2 — CID 138743523
[(R)-[(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-fluoroquinolin-4-yl)methyl] acetate (PubChem CID 138743523) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is [(R)-[(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-fluoroquinolin-4-yl)methyl] acetate.
| Compound Name | [(R)-[(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-fluoroquinolin-4-yl)methyl] acetate |
|---|---|
| PubChem CID | 138743523 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(R)-[(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-fluoroquinolin-4-yl)methyl] acetate |
| SMILES | C=C[C@H]1CN2CCC1CC2[C@H](OC(C)=O)c1ccnc2ccc(F)cc12 |
| InChI | InChI=1S/C21H23FN2O2/c1-3-14-12-24-9-7-15(14)10-20(24)21(26-13(2)25)17-6-8-23-19-5-4-16(22)11-18(17)19/h3-6,8,11,14-15,20-21H,1,7,9-10,12H2,2H3/t14-,15?,20?,21+/m0/s1 |
| InChIKey | XOGDYFMGYPWRPZ-CMQVZKDFSA-N |
| XLogP | 3.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|