C23H31F3N2OSi — CID 586615
[(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[7-(trifluoromethyl)quinolin-4-yl]methoxy]-trimethylsilane (PubChem CID 586615) has the molecular formula C23H31F3N2OSi and a molecular weight of 436.59 g/mol. Its IUPAC name is [(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[7-(trifluoromethyl)quinolin-4-yl]methoxy]-trimethylsilane.
| Compound Name | [(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[7-(trifluoromethyl)quinolin-4-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 586615 |
| Molecular Formula | C23H31F3N2OSi |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[7-(trifluoromethyl)quinolin-4-yl]methoxy]-trimethylsilane |
| SMILES | CCC1CN2CCC1CC2C(O[Si](C)(C)C)c1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C23H31F3N2OSi/c1-5-15-14-28-11-9-16(15)12-21(28)22(29-30(2,3)4)19-8-10-27-20-13-17(23(24,25)26)6-7-18(19)20/h6-8,10,13,15-16,21-22H,5,9,11-12,14H2,1-4H3 |
| InChIKey | XGWYDPFEFHSVDQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|