C22H18F2O7S — CID 10939539
dimethyl 3-(3,5-difluorophenyl)-4-(4-methylsulfonylphenyl)-2-oxocyclopent-3-ene-1,1-dicarboxylate (PubChem CID 10939539) has the molecular formula C22H18F2O7S and a molecular weight of 464.44 g/mol. Its IUPAC name is dimethyl 3-(3,5-difluorophenyl)-4-(4-methylsulfonylphenyl)-2-oxocyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(3,5-difluorophenyl)-4-(4-methylsulfonylphenyl)-2-oxocyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10939539 |
| Molecular Formula | C22H18F2O7S |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | dimethyl 3-(3,5-difluorophenyl)-4-(4-methylsulfonylphenyl)-2-oxocyclopent-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccc(S(C)(=O)=O)cc2)=C(c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C22H18F2O7S/c1-30-20(26)22(21(27)31-2)11-17(12-4-6-16(7-5-12)32(3,28)29)18(19(22)25)13-8-14(23)10-15(24)9-13/h4-10H,11H2,1-3H3 |
| InChIKey | HOSRAVBELLIYJF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|