C15H19ClF2N2O3 — CID 109396930
3-[3-chloro-4-(difluoromethoxy)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea (PubChem CID 109396930) has the molecular formula C15H19ClF2N2O3 and a molecular weight of 348.78 g/mol. Its IUPAC name is 3-[3-chloro-4-(difluoromethoxy)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea.
| Compound Name | 3-[3-chloro-4-(difluoromethoxy)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 109396930 |
| Molecular Formula | C15H19ClF2N2O3 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-[3-chloro-4-(difluoromethoxy)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
| SMILES | CN(CC1CCCC1O)C(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClF2N2O3/c1-20(8-9-3-2-4-12(9)21)15(22)19-10-5-6-13(11(16)7-10)23-14(17)18/h5-7,9,12,14,21H,2-4,8H2,1H3,(H,19,22) |
| InChIKey | SPHVRAFMRWYCLR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |