C18H25FN2O3 — CID 109397107
3-(4-cyclobutyloxy-3-fluorophenyl)-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea (PubChem CID 109397107) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-(4-cyclobutyloxy-3-fluorophenyl)-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea.
| Compound Name | 3-(4-cyclobutyloxy-3-fluorophenyl)-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 109397107 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-(4-cyclobutyloxy-3-fluorophenyl)-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
| SMILES | CN(CC1CCCC1O)C(=O)Nc1ccc(OC2CCC2)c(F)c1 |
| InChI | InChI=1S/C18H25FN2O3/c1-21(11-12-4-2-7-16(12)22)18(23)20-13-8-9-17(15(19)10-13)24-14-5-3-6-14/h8-10,12,14,16,22H,2-7,11H2,1H3,(H,20,23) |
| InChIKey | OQFGTYNGTZRPHO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |