C17H24N2O3 — CID 109397009
1-[(2-hydroxycyclopentyl)methyl]-1-methyl-3-(3-prop-2-enoxyphenyl)urea (PubChem CID 109397009) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[(2-hydroxycyclopentyl)methyl]-1-methyl-3-(3-prop-2-enoxyphenyl)urea.
| Compound Name | 1-[(2-hydroxycyclopentyl)methyl]-1-methyl-3-(3-prop-2-enoxyphenyl)urea |
|---|---|
| PubChem CID | 109397009 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[(2-hydroxycyclopentyl)methyl]-1-methyl-3-(3-prop-2-enoxyphenyl)urea |
| SMILES | C=CCOc1cccc(NC(=O)N(C)CC2CCCC2O)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-3-10-22-15-8-5-7-14(11-15)18-17(21)19(2)12-13-6-4-9-16(13)20/h3,5,7-8,11,13,16,20H,1,4,6,9-10,12H2,2H3,(H,18,21) |
| InChIKey | RMEUIWTUSOCRFJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|