C14H13BrF3N5O — CID 1093974
(5R,7R)-N-(4-bromo-2-fluorophenyl)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1093974) has the molecular formula C14H13BrF3N5O and a molecular weight of 404.19 g/mol. Its IUPAC name is (5R,7R)-N-(4-bromo-2-fluorophenyl)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-N-(4-bromo-2-fluorophenyl)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1093974 |
| Molecular Formula | C14H13BrF3N5O |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (5R,7R)-N-(4-bromo-2-fluorophenyl)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](C(F)F)n2nc(C(=O)Nc3ccc(Br)cc3F)nc2N1 |
| InChI | InChI=1S/C14H13BrF3N5O/c1-6-4-10(11(17)18)23-14(19-6)21-12(22-23)13(24)20-9-3-2-7(15)5-8(9)16/h2-3,5-6,10-11H,4H2,1H3,(H,20,24)(H,19,21,22)/t6-,10-/m1/s1 |
| InChIKey | DJGWYQLWAJGNDL-LHLIQPBNSA-N |
| XLogP | 3.44 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |