C17H25FN2O2 — CID 109397881
N-[(2-fluorophenyl)methyl]-2-[(2-hydroxycyclopentyl)methyl-methylamino]propanamide (PubChem CID 109397881) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[(2-hydroxycyclopentyl)methyl-methylamino]propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[(2-hydroxycyclopentyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 109397881 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[(2-hydroxycyclopentyl)methyl-methylamino]propanamide |
| SMILES | CC(C(=O)NCc1ccccc1F)N(C)CC1CCCC1O |
| InChI | InChI=1S/C17H25FN2O2/c1-12(20(2)11-14-7-5-9-16(14)21)17(22)19-10-13-6-3-4-8-15(13)18/h3-4,6,8,12,14,16,21H,5,7,9-11H2,1-2H3,(H,19,22) |
| InChIKey | GZBRTHBKNAXEHM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |