C14H21FN2O — CID 95262158
(2S)-N-[(2-fluorophenyl)methyl]-2-[methyl(propyl)amino]propanamide (PubChem CID 95262158) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is (2S)-N-[(2-fluorophenyl)methyl]-2-[methyl(propyl)amino]propanamide.
| Compound Name | (2S)-N-[(2-fluorophenyl)methyl]-2-[methyl(propyl)amino]propanamide |
|---|---|
| PubChem CID | 95262158 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2S)-N-[(2-fluorophenyl)methyl]-2-[methyl(propyl)amino]propanamide |
| SMILES | CCCN(C)[C@@H](C)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C14H21FN2O/c1-4-9-17(3)11(2)14(18)16-10-12-7-5-6-8-13(12)15/h5-8,11H,4,9-10H2,1-3H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | ZGUDCAZHHXPTIY-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |