C30H30N2O4 — CID 10939797
6-(1-phenylbut-3-enyl)-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 10939797) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 6-(1-phenylbut-3-enyl)-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 6-(1-phenylbut-3-enyl)-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10939797 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 6-(1-phenylbut-3-enyl)-1,3-bis(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | C=CCC(c1ccccc1)c1cc(=O)n(COCc2ccccc2)c(=O)n1COCc1ccccc1 |
| InChI | InChI=1S/C30H30N2O4/c1-2-12-27(26-17-10-5-11-18-26)28-19-29(33)32(23-36-21-25-15-8-4-9-16-25)30(34)31(28)22-35-20-24-13-6-3-7-14-24/h2-11,13-19,27H,1,12,20-23H2 |
| InChIKey | OCDMHGLVWGTACN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|