C15H25N3O2 — CID 109399207
1-(1-hydroxy-4-methylpentan-2-yl)-3-[2-(3-methyl-4-pyridinyl)ethyl]urea (PubChem CID 109399207) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(1-hydroxy-4-methylpentan-2-yl)-3-[2-(3-methyl-4-pyridinyl)ethyl]urea.
| Compound Name | 1-(1-hydroxy-4-methylpentan-2-yl)-3-[2-(3-methyl-4-pyridinyl)ethyl]urea |
|---|---|
| PubChem CID | 109399207 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-(1-hydroxy-4-methylpentan-2-yl)-3-[2-(3-methyl-4-pyridinyl)ethyl]urea |
| SMILES | Cc1cnccc1CCNC(=O)NC(CO)CC(C)C |
| InChI | InChI=1S/C15H25N3O2/c1-11(2)8-14(10-19)18-15(20)17-7-5-13-4-6-16-9-12(13)3/h4,6,9,11,14,19H,5,7-8,10H2,1-3H3,(H2,17,18,20) |
| InChIKey | GNOFUMMSHNRRRD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |