C31H34O6 — CID 10940064
(2R,5S,6S)-6-ethoxy-5-(2-methyl-1,3-dioxolan-2-yl)-2-(trityloxymethyl)oxan-3-one (PubChem CID 10940064) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2R,5S,6S)-6-ethoxy-5-(2-methyl-1,3-dioxolan-2-yl)-2-(trityloxymethyl)oxan-3-one.
| Compound Name | (2R,5S,6S)-6-ethoxy-5-(2-methyl-1,3-dioxolan-2-yl)-2-(trityloxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 10940064 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (2R,5S,6S)-6-ethoxy-5-(2-methyl-1,3-dioxolan-2-yl)-2-(trityloxymethyl)oxan-3-one |
| SMILES | CCO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)C[C@@H]1C1(C)OCCO1 |
| InChI | InChI=1S/C31H34O6/c1-3-33-29-26(30(2)34-19-20-35-30)21-27(32)28(37-29)22-36-31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,26,28-29H,3,19-22H2,1-2H3/t26-,28+,29-/m0/s1 |
| InChIKey | QTKKCFMALSZIPC-MKYKQAKUSA-N |
| XLogP | 5.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|