C22H35IN6 — CID 109400712
N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109400712) has the molecular formula C22H35IN6 and a molecular weight of 510.47 g/mol. Its IUPAC name is N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109400712 |
| Molecular Formula | C22H35IN6 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H34N6.HI/c1-5-20-19(21(6-2)26(4)25-20)17-24-22(23-7-3)28-15-13-27(14-16-28)18-11-9-8-10-12-18;/h8-12H,5-7,13-17H2,1-4H3,(H,23,24);1H |
| InChIKey | WSYICFZGVUAUGV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|