C23H35IN4O2 — CID 109401814
4-(4-methoxyphenyl)-N'-methyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109401814) has the molecular formula C23H35IN4O2 and a molecular weight of 526.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N'-methyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-methoxyphenyl)-N'-methyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109401814 |
| Molecular Formula | C23H35IN4O2 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-N'-methyl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NC1C2CCOC2C12CCCC2)N1CCN(c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C23H34N4O2.HI/c1-24-22(25-20-19-9-16-29-21(19)23(20)10-3-4-11-23)27-14-12-26(13-15-27)17-5-7-18(28-2)8-6-17;/h5-8,19-21H,3-4,9-16H2,1-2H3,(H,24,25);1H |
| InChIKey | XELFVEZBGDWPRJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|