C20H26F3N3O — CID 109401975
2-methyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 109401975) has the molecular formula C20H26F3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-methyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109401975 |
| Molecular Formula | C20H26F3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-methyl-1-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(C(F)(F)F)c1)NC1C2CCOC2C12CCCC2 |
| InChI | InChI=1S/C20H26F3N3O/c1-24-18(25-12-13-5-4-6-14(11-13)20(21,22)23)26-16-15-7-10-27-17(15)19(16)8-2-3-9-19/h4-6,11,15-17H,2-3,7-10,12H2,1H3,(H2,24,25,26) |
| InChIKey | OVZJWJLYJWGENI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|