C22H29IN4O — CID 109406465
2-methyl-1-(quinolin-4-ylmethyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide (PubChem CID 109406465) has the molecular formula C22H29IN4O and a molecular weight of 492.41 g/mol. Its IUPAC name is 2-methyl-1-(quinolin-4-ylmethyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-(quinolin-4-ylmethyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109406465 |
| Molecular Formula | C22H29IN4O |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-methyl-1-(quinolin-4-ylmethyl)-3-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc2ccccc12)NC1C2CCOC2C12CCCC2.I |
| InChI | InChI=1S/C22H28N4O.HI/c1-23-21(25-14-15-8-12-24-18-7-3-2-6-16(15)18)26-19-17-9-13-27-20(17)22(19)10-4-5-11-22;/h2-3,6-8,12,17,19-20H,4-5,9-11,13-14H2,1H3,(H2,23,25,26);1H |
| InChIKey | DUQHZCZAXLJTOV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|