C20H38N6 — CID 109402911
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 109402911) has the molecular formula C20H38N6 and a molecular weight of 362.57 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109402911 |
| Molecular Formula | C20H38N6 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)NCCCN1CCCCC1C |
| InChI | InChI=1S/C20H38N6/c1-6-18-17(19(7-2)25(5)24-18)15-23-20(21-4)22-12-10-14-26-13-9-8-11-16(26)3/h16H,6-15H2,1-5H3,(H2,21,22,23) |
| InChIKey | OMSNFDQTKKAMQK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|