C24H35N5 — CID 109403344
1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 109403344) has the molecular formula C24H35N5 and a molecular weight of 393.58 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109403344 |
| Molecular Formula | C24H35N5 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 1-ethyl-3-[2-(3-methyl-4-pyridinyl)ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCCC2)cc1)NCCc1ccncc1C |
| InChI | InChI=1S/C24H35N5/c1-3-26-24(27-14-12-23-11-13-25-17-20(23)2)28-18-21-7-9-22(10-8-21)19-29-15-5-4-6-16-29/h7-11,13,17H,3-6,12,14-16,18-19H2,1-2H3,(H2,26,27,28) |
| InChIKey | RMMHDIIDIXRVSG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|