C20H32F3N5 — CID 111839821
1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111839821) has the molecular formula C20H32F3N5 and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111839821 |
| Molecular Formula | C20H32F3N5 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2)cc1)NCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C20H32F3N5/c1-3-24-19(25-10-13-27(2)16-20(21,22)23)26-14-17-6-8-18(9-7-17)15-28-11-4-5-12-28/h6-9H,3-5,10-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | SZSRSNKLPXFBKR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|