C22H39N5O — CID 111411229
1-ethyl-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111411229) has the molecular formula C22H39N5O and a molecular weight of 389.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111411229 |
| Molecular Formula | C22H39N5O |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.32 |
| IUPAC Name | 1-ethyl-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCCC2)cc1)NCCN(C)CCOC |
| InChI | InChI=1S/C22H39N5O/c1-4-23-22(24-12-15-26(2)16-17-28-3)25-18-20-8-10-21(11-9-20)19-27-13-6-5-7-14-27/h8-11H,4-7,12-19H2,1-3H3,(H2,23,24,25) |
| InChIKey | VMSSWEJQBPYMQH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|