C25H37N3O2 — CID 109403557
N'-ethyl-3-(phenylmethoxymethyl)-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpyrrolidine-1-carboximidamide (PubChem CID 109403557) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N'-ethyl-3-(phenylmethoxymethyl)-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-ethyl-3-(phenylmethoxymethyl)-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 109403557 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N'-ethyl-3-(phenylmethoxymethyl)-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-ylpyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1C2CCOC2C12CCCC2)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C25H37N3O2/c1-2-26-24(27-22-21-11-15-30-23(21)25(22)12-6-7-13-25)28-14-10-20(16-28)18-29-17-19-8-4-3-5-9-19/h3-5,8-9,20-23H,2,6-7,10-18H2,1H3,(H,26,27) |
| InChIKey | YILPXNPRNXLTQE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|