C18H34IN3O2 — CID 119162471
N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119162471) has the molecular formula C18H34IN3O2 and a molecular weight of 451.39 g/mol. Its IUPAC name is N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119162471 |
| Molecular Formula | C18H34IN3O2 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CC/N=C(/NC1C2CCCOC2C1(C)C)N1CCC(COC)C1.I |
| InChI | InChI=1S/C18H33N3O2.HI/c1-5-19-17(21-9-8-13(11-21)12-22-4)20-15-14-7-6-10-23-16(14)18(15,2)3;/h13-16H,5-12H2,1-4H3,(H,19,20);1H |
| InChIKey | IGNIYVFVEYWVJU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|