C22H40N4O — CID 119162692
N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 119162692) has the molecular formula C22H40N4O and a molecular weight of 376.59 g/mol. Its IUPAC name is N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119162692 |
| Molecular Formula | C22H40N4O |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-ethyl-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1C2CCCOC2C1(C)C)N1CCC(CN2CCCCC2)C1 |
| InChI | InChI=1S/C22H40N4O/c1-4-23-21(24-19-18-9-8-14-27-20(18)22(19,2)3)26-13-10-17(16-26)15-25-11-6-5-7-12-25/h17-20H,4-16H2,1-3H3,(H,23,24) |
| InChIKey | MCUYYDDVZLCRMX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|