C20H34N4O — CID 109395046
N'-ethyl-3-pyrrolidin-1-yl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylpyrrolidine-1-carboximidamide (PubChem CID 109395046) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is N'-ethyl-3-pyrrolidin-1-yl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-ethyl-3-pyrrolidin-1-yl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 109395046 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | N'-ethyl-3-pyrrolidin-1-yl-N-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-ylpyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1C2CCOC2C12CCC2)N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C20H34N4O/c1-2-21-19(24-12-6-15(14-24)23-10-3-4-11-23)22-17-16-7-13-25-18(16)20(17)8-5-9-20/h15-18H,2-14H2,1H3,(H,21,22) |
| InChIKey | FPTCPNFFHQIEPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|