C19H32IN5S — CID 109403771
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109403771) has the molecular formula C19H32IN5S and a molecular weight of 489.47 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109403771 |
| Molecular Formula | C19H32IN5S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N/C)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C19H31N5S.HI/c1-7-15-14(16(8-2)24(6)23-15)12-21-18(20-5)22-13-19(3,4)17-10-9-11-25-17;/h9-11H,7-8,12-13H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | ZXLWLHYCNFFUTI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|