C18H30IN5S — CID 111582067
2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111582067) has the molecular formula C18H30IN5S and a molecular weight of 475.44 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111582067 |
| Molecular Formula | C18H30IN5S |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c(C)nn(C)c1C)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C18H29N5S.HI/c1-13-15(14(2)23(6)22-13)9-10-20-17(19-5)21-12-18(3,4)16-8-7-11-24-16;/h7-8,11H,9-10,12H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | NEMXFVBSMSGWOL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|