C30H43NO5S — CID 10940386
(2R,5R)-3-(benzenesulfonyl)-5-(4-phenylmethoxybutyl)-2-[3-(2-propyl-1,3-dioxolan-2-yl)propyl]pyrrolidine (PubChem CID 10940386) has the molecular formula C30H43NO5S and a molecular weight of 529.74 g/mol. Its IUPAC name is (2R,5R)-3-(benzenesulfonyl)-5-(4-phenylmethoxybutyl)-2-[3-(2-propyl-1,3-dioxolan-2-yl)propyl]pyrrolidine.
| Compound Name | (2R,5R)-3-(benzenesulfonyl)-5-(4-phenylmethoxybutyl)-2-[3-(2-propyl-1,3-dioxolan-2-yl)propyl]pyrrolidine |
|---|---|
| PubChem CID | 10940386 |
| Molecular Formula | C30H43NO5S |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | (2R,5R)-3-(benzenesulfonyl)-5-(4-phenylmethoxybutyl)-2-[3-(2-propyl-1,3-dioxolan-2-yl)propyl]pyrrolidine |
| SMILES | CCCC1(CCC[C@H]2N[C@H](CCCCOCc3ccccc3)CC2S(=O)(=O)c2ccccc2)OCCO1 |
| InChI | InChI=1S/C30H43NO5S/c1-2-18-30(35-21-22-36-30)19-11-17-28-29(37(32,33)27-15-7-4-8-16-27)23-26(31-28)14-9-10-20-34-24-25-12-5-3-6-13-25/h3-8,12-13,15-16,26,28-29,31H,2,9-11,14,17-24H2,1H3/t26-,28-,29?/m1/s1 |
| InChIKey | QXEQTQZLUBDYEY-QDKNURMMSA-N |
| XLogP | 5.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|