C26H35NO6S — CID 11705839
N-[(1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propan-2-amine (PubChem CID 11705839) has the molecular formula C26H35NO6S and a molecular weight of 489.63 g/mol. Its IUPAC name is N-[(1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propan-2-amine.
| Compound Name | N-[(1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propan-2-amine |
|---|---|
| PubChem CID | 11705839 |
| Molecular Formula | C26H35NO6S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propan-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](NC(C)C)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H35NO6S/c1-17(2)27-21(16-34(28,29)20-13-11-18(3)12-14-20)22-23(30-15-19-9-7-6-8-10-19)24-25(31-22)33-26(4,5)32-24/h6-14,17,21-25,27H,15-16H2,1-5H3/t21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | HPSUCWBEPNDBTQ-FXEFVXDJSA-N |
| XLogP | 3.60 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |