C30H35NO6S — CID 11504786
(1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-2-(4-methylphenyl)sulfonylethanamine (PubChem CID 11504786) has the molecular formula C30H35NO6S and a molecular weight of 537.68 g/mol. Its IUPAC name is (1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-2-(4-methylphenyl)sulfonylethanamine.
| Compound Name | (1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-2-(4-methylphenyl)sulfonylethanamine |
|---|---|
| PubChem CID | 11504786 |
| Molecular Formula | C30H35NO6S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-2-(4-methylphenyl)sulfonylethanamine |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](NCc2ccccc2)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H35NO6S/c1-21-14-16-24(17-15-21)38(32,33)20-25(31-18-22-10-6-4-7-11-22)26-27(34-19-23-12-8-5-9-13-23)28-29(35-26)37-30(2,3)36-28/h4-17,25-29,31H,18-20H2,1-3H3/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | XRHUAKPYKOOVAX-XYPQWYOHSA-N |
| XLogP | 4.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |