C27H29NO6S — CID 101067777
(4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-benzyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine (PubChem CID 101067777) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is (4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-benzyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine.
| Compound Name | (4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-benzyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
|---|---|
| PubChem CID | 101067777 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-N-benzyl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccccc2)[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C27H29NO6S/c1-31-27-23(28-17-19-11-5-2-6-12-19)25(35(29,30)21-15-9-4-10-16-21)24-22(33-27)18-32-26(34-24)20-13-7-3-8-14-20/h2-16,22-28H,17-18H2,1H3/t22-,23-,24-,25-,26?,27+/m1/s1 |
| InChIKey | KFZSLTUWCJHHRX-SIUAEXTNSA-N |
| XLogP | 3.47 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |