C22H27NO7S — CID 3359846
[7-(benzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate (PubChem CID 3359846) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is [7-(benzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate.
| Compound Name | [7-(benzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
|---|---|
| PubChem CID | 3359846 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [7-(benzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(OS(C)(=O)=O)C1NCc1ccccc1 |
| InChI | InChI=1S/C22H27NO7S/c1-26-22-18(23-13-15-9-5-3-6-10-15)20(30-31(2,24)25)19-17(28-22)14-27-21(29-19)16-11-7-4-8-12-16/h3-12,17-23H,13-14H2,1-2H3 |
| InChIKey | PWNMKXZTEXGGMG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|