C24H29NO7S — CID 10600640
4-[(2R,4aR,6R,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine (PubChem CID 10600640) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is 4-[(2R,4aR,6R,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine.
| Compound Name | 4-[(2R,4aR,6R,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine |
|---|---|
| PubChem CID | 10600640 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 4-[(2R,4aR,6R,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccccc2)[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C24H29NO7S/c1-28-24-20(25-12-14-29-15-13-25)22(33(26,27)18-10-6-3-7-11-18)21-19(31-24)16-30-23(32-21)17-8-4-2-5-9-17/h2-11,19-24H,12-16H2,1H3/t19-,20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | DPAXXCZECAXHAH-TZNXUKFXSA-N |
| XLogP | 2.02 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |